C26H24N6OS — CID 2320363
(2Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-2-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)acetonitrile (PubChem CID 2320363) has the molecular formula C26H24N6OS and a molecular weight of 468.59 g/mol. Its IUPAC name is (2Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-2-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)acetonitrile.
| Compound Name | (2Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-2-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)acetonitrile |
|---|---|
| PubChem CID | 2320363 |
| Molecular Formula | C26H24N6OS |
| Molecular Weight | 468.59 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (2Z)-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)-2-(4-phenyl-3-prop-2-enyl-1,3-thiazol-2-ylidene)acetonitrile |
| SMILES | C=CCN1C(c2ccccc2)=CS/C1=C(/C#N)c1nnc(N2CCOCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H24N6OS/c1-2-13-31-23(20-9-5-3-6-10-20)19-34-25(31)22(18-27)24-28-29-26(30-14-16-33-17-15-30)32(24)21-11-7-4-8-12-21/h2-12,19H,1,13-17H2/b25-22- |
| InChIKey | WFPSOLYANZNWNI-LVWGJNHUSA-N |
| XLogP | 4.53 |
| TPSA | 70.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.59 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|