About 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile
3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile (PubChem CID 2320395) has the molecular formula C17H18N2O3
and a molecular weight of 298.34 g/mol. Its IUPAC name is 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile.
Molecular Properties
| Compound Name | 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile |
| PubChem CID | 2320395 |
| Molecular Formula | C17H18N2O3 |
| Molecular Weight | 298.34 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile |
| SMILES | COc1cc(C#N)ccc1OCC(=O)c1cc(C)n(C)c1C |
| InChI | InChI=1S/C17H18N2O3/c1-11-7-14(12(2)19(11)3)15(20)10-22-16-6-5-13(9-18)8-17(16)21-4/h5-8H,10H2,1-4H3 |
| InChIKey | GKWFRNBJXOUAPY-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 64.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.34 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile?
The IUPAC name of 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile (CID 2320395) is 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile.
What is the SMILES notation for 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile?
The canonical SMILES for 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile is COc1cc(C#N)ccc1OCC(=O)c1cc(C)n(C)c1C.
What is the InChIKey of 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile?
The InChIKey is GKWFRNBJXOUAPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O3/c1-11-7-14(12(2)19(11)3)15(20)10-22-16-6-5-13(9-18)8-17(16)21-4/h5-8H,10H2,1-4H3.
What are the key properties of 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile?
3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile has a molecular weight of 298.34 g/mol, XLogP of 2.78, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-4-[2-oxo-2-(1,2,5-trimethylpyrrol-3-yl)ethoxy]benzonitrile is sourced from PubChem (CID 2320395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).