C21H20N2O4 — CID 23204505
methyl 1-(2,3,4a,7,8,8a-hexahydro-1,4-benzodioxin-7-yl)-9H-pyrido[3,4-b]indole-3-carboxylate (PubChem CID 23204505) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is methyl 1-(2,3,4a,7,8,8a-hexahydro-1,4-benzodioxin-7-yl)-9H-pyrido[3,4-b]indole-3-carboxylate.
| Compound Name | methyl 1-(2,3,4a,7,8,8a-hexahydro-1,4-benzodioxin-7-yl)-9H-pyrido[3,4-b]indole-3-carboxylate |
|---|---|
| PubChem CID | 23204505 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | methyl 1-(2,3,4a,7,8,8a-hexahydro-1,4-benzodioxin-7-yl)-9H-pyrido[3,4-b]indole-3-carboxylate |
| SMILES | COC(=O)c1cc2c([nH]c3ccccc32)c(C2C=CC3OCCOC3C2)n1 |
| InChI | InChI=1S/C21H20N2O4/c1-25-21(24)16-11-14-13-4-2-3-5-15(13)22-20(14)19(23-16)12-6-7-17-18(10-12)27-9-8-26-17/h2-7,11-12,17-18,22H,8-10H2,1H3 |
| InChIKey | IIFLZPSRJQJSPE-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 73.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|