C26H23BrN6OS — CID 2320519
(2E)-2-[4-(4-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile (PubChem CID 2320519) has the molecular formula C26H23BrN6OS and a molecular weight of 547.48 g/mol. Its IUPAC name is (2E)-2-[4-(4-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile.
| Compound Name | (2E)-2-[4-(4-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile |
|---|---|
| PubChem CID | 2320519 |
| Molecular Formula | C26H23BrN6OS |
| Molecular Weight | 547.48 g/mol |
| Exact Mass | 546.08 |
| IUPAC Name | (2E)-2-[4-(4-bromophenyl)-3-prop-2-enyl-1,3-thiazol-2-ylidene]-2-(5-morpholin-4-yl-4-phenyl-1,2,4-triazol-3-yl)acetonitrile |
| SMILES | C=CCN1C(c2ccc(Br)cc2)=CS/C1=C(\C#N)c1nnc(N2CCOCC2)n1-c1ccccc1 |
| InChI | InChI=1S/C26H23BrN6OS/c1-2-12-32-23(19-8-10-20(27)11-9-19)18-35-25(32)22(17-28)24-29-30-26(31-13-15-34-16-14-31)33(24)21-6-4-3-5-7-21/h2-11,18H,1,12-16H2/b25-22+ |
| InChIKey | RPPDOGWFJZOEQX-YYDJUVGSSA-N |
| XLogP | 5.29 |
| TPSA | 70.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.48 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|