About 2,4-dimethylpyrimido[1,2-b]indazole
2,4-dimethylpyrimido[1,2-b]indazole (PubChem CID 2320560) has the molecular formula C12H11N3
and a molecular weight of 197.24 g/mol. Its IUPAC name is 2,4-dimethylpyrimido[1,2-b]indazole.
Molecular Properties
| Compound Name | 2,4-dimethylpyrimido[1,2-b]indazole |
| PubChem CID | 2320560 |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.10 |
| IUPAC Name | 2,4-dimethylpyrimido[1,2-b]indazole |
| SMILES | Cc1cc(C)n2nc3ccccc3c2n1 |
| InChI | InChI=1S/C12H11N3/c1-8-7-9(2)15-12(13-8)10-5-3-4-6-11(10)14-15/h3-7H,1-2H3 |
| InChIKey | HHIBOZOJVJURDY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,4-dimethylpyrimido[1,2-b]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dimethylpyrimido[1,2-b]indazole?
The IUPAC name of 2,4-dimethylpyrimido[1,2-b]indazole (CID 2320560) is 2,4-dimethylpyrimido[1,2-b]indazole.
What is the SMILES notation for 2,4-dimethylpyrimido[1,2-b]indazole?
The canonical SMILES for 2,4-dimethylpyrimido[1,2-b]indazole is Cc1cc(C)n2nc3ccccc3c2n1.
What is the InChIKey of 2,4-dimethylpyrimido[1,2-b]indazole?
The InChIKey is HHIBOZOJVJURDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11N3/c1-8-7-9(2)15-12(13-8)10-5-3-4-6-11(10)14-15/h3-7H,1-2H3.
What are the key properties of 2,4-dimethylpyrimido[1,2-b]indazole?
2,4-dimethylpyrimido[1,2-b]indazole has a molecular weight of 197.24 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dimethylpyrimido[1,2-b]indazole is sourced from PubChem (CID 2320560), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).