C30H33FN2O3 — CID 23206155
5-(4-fluorophenyl)-8-methyl-7-methylidene-1-phenyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)nonane-2,4,6-triol (PubChem CID 23206155) has the molecular formula C30H33FN2O3 and a molecular weight of 488.60 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-8-methyl-7-methylidene-1-phenyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)nonane-2,4,6-triol.
| Compound Name | 5-(4-fluorophenyl)-8-methyl-7-methylidene-1-phenyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)nonane-2,4,6-triol |
|---|---|
| PubChem CID | 23206155 |
| Molecular Formula | C30H33FN2O3 |
| Molecular Weight | 488.60 g/mol |
| Exact Mass | 488.25 |
| IUPAC Name | 5-(4-fluorophenyl)-8-methyl-7-methylidene-1-phenyl-2-(1H-pyrrolo[2,3-b]pyridin-5-yl)nonane-2,4,6-triol |
| SMILES | C=C(C(C)C)C(O)C(c1ccc(F)cc1)C(O)CC(O)(Cc1ccccc1)c1cnc2[nH]ccc2c1 |
| InChI | InChI=1S/C30H33FN2O3/c1-19(2)20(3)28(35)27(22-9-11-25(31)12-10-22)26(34)17-30(36,16-21-7-5-4-6-8-21)24-15-23-13-14-32-29(23)33-18-24/h4-15,18-19,26-28,34-36H,3,16-17H2,1-2H3,(H,32,33) |
| InChIKey | HXBGTEUYLUSRPX-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 89.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.60 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|