About [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate
[8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate (PubChem CID 23206487) has the molecular formula C16H13ClF3N3O4
and a molecular weight of 403.74 g/mol. Its IUPAC name is [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate.
Molecular Properties
| Compound Name | [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate |
| PubChem CID | 23206487 |
| Molecular Formula | C16H13ClF3N3O4 |
| Molecular Weight | 403.74 g/mol |
| Exact Mass | 403.05 |
| IUPAC Name | [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1nc2c(=O)[nH]c3cc(C(F)(F)F)c(Cl)cc3n2c1CC |
| InChI | InChI=1S/C16H13ClF3N3O4/c1-3-10-14(27-15(25)26-4-2)22-12-13(24)21-9-5-7(16(18,19)20)8(17)6-11(9)23(10)12/h5-6H,3-4H2,1-2H3,(H,21,24) |
| InChIKey | XLTBHTGQADREIX-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 85.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.74 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate?
The IUPAC name of [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate (CID 23206487) is [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate.
What is the SMILES notation for [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate?
The canonical SMILES for [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate is CCOC(=O)Oc1nc2c(=O)[nH]c3cc(C(F)(F)F)c(Cl)cc3n2c1CC.
What is the InChIKey of [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate?
The InChIKey is XLTBHTGQADREIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13ClF3N3O4/c1-3-10-14(27-15(25)26-4-2)22-12-13(24)21-9-5-7(16(18,19)20)8(17)6-11(9)23(10)12/h5-6H,3-4H2,1-2H3,(H,21,24).
What are the key properties of [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate?
[8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate has a molecular weight of 403.74 g/mol, XLogP of 3.95, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [8-chloro-1-ethyl-4-oxo-7-(trifluoromethyl)-5H-imidazo[1,2-a]quinoxalin-2-yl] ethyl carbonate is sourced from PubChem (CID 23206487), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).