C14H19F3NO3P — CID 23206537
4-diethoxyphosphoryl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 23206537) has the molecular formula C14H19F3NO3P and a molecular weight of 337.28 g/mol. Its IUPAC name is 4-diethoxyphosphoryl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 4-diethoxyphosphoryl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 23206537 |
| Molecular Formula | C14H19F3NO3P |
| Molecular Weight | 337.28 g/mol |
| Exact Mass | 337.11 |
| IUPAC Name | 4-diethoxyphosphoryl-6-(trifluoromethyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | CCOP(=O)(OCC)C1CCNc2ccc(C(F)(F)F)cc21 |
| InChI | InChI=1S/C14H19F3NO3P/c1-3-20-22(19,21-4-2)13-7-8-18-12-6-5-10(9-11(12)13)14(15,16)17/h5-6,9,13,18H,3-4,7-8H2,1-2H3 |
| InChIKey | WHYXBRBRICPGTH-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.28 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|