About N-methyl-4-phenylaniline;hydrochloride
N-methyl-4-phenylaniline;hydrochloride (PubChem CID 23207854) has the molecular formula C13H14ClN
and a molecular weight of 219.72 g/mol. Its IUPAC name is N-methyl-4-phenylaniline;hydrochloride.
Molecular Properties
| Compound Name | N-methyl-4-phenylaniline;hydrochloride |
| PubChem CID | 23207854 |
| Molecular Formula | C13H14ClN |
| Molecular Weight | 219.72 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | N-methyl-4-phenylaniline;hydrochloride |
| SMILES | CNc1ccc(-c2ccccc2)cc1.Cl |
| InChI | InChI=1S/C13H13N.ClH/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-10,14H,1H3;1H |
| InChIKey | JHVDXYKRPSSZCM-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.72 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-methyl-4-phenylaniline;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-4-phenylaniline;hydrochloride?
The IUPAC name of N-methyl-4-phenylaniline;hydrochloride (CID 23207854) is N-methyl-4-phenylaniline;hydrochloride.
What is the SMILES notation for N-methyl-4-phenylaniline;hydrochloride?
The canonical SMILES for N-methyl-4-phenylaniline;hydrochloride is CNc1ccc(-c2ccccc2)cc1.Cl.
What is the InChIKey of N-methyl-4-phenylaniline;hydrochloride?
The InChIKey is JHVDXYKRPSSZCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.ClH/c1-14-13-9-7-12(8-10-13)11-5-3-2-4-6-11;/h2-10,14H,1H3;1H.
What are the key properties of N-methyl-4-phenylaniline;hydrochloride?
N-methyl-4-phenylaniline;hydrochloride has a molecular weight of 219.72 g/mol, XLogP of 3.82, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-4-phenylaniline;hydrochloride is sourced from PubChem (CID 23207854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).