About 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene
5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene (PubChem CID 23208412) has the molecular formula C13H8F4O
and a molecular weight of 256.20 g/mol. Its IUPAC name is 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene.
Molecular Properties
| Compound Name | 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene |
| PubChem CID | 23208412 |
| Molecular Formula | C13H8F4O |
| Molecular Weight | 256.20 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene |
| SMILES | Fc1cc(OC(F)F)cc(-c2ccccc2)c1F |
| InChI | InChI=1S/C13H8F4O/c14-11-7-9(18-13(16)17)6-10(12(11)15)8-4-2-1-3-5-8/h1-7,13H |
| InChIKey | NDLRSZIJXBHBFP-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.20 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene?
The IUPAC name of 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene (CID 23208412) is 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene.
What is the SMILES notation for 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene?
The canonical SMILES for 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene is Fc1cc(OC(F)F)cc(-c2ccccc2)c1F.
What is the InChIKey of 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene?
The InChIKey is NDLRSZIJXBHBFP-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8F4O/c14-11-7-9(18-13(16)17)6-10(12(11)15)8-4-2-1-3-5-8/h1-7,13H.
What are the key properties of 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene?
5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene has a molecular weight of 256.20 g/mol, XLogP of 4.23, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(difluoromethoxy)-1,2-difluoro-3-phenylbenzene is sourced from PubChem (CID 23208412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).