C10H10Br2O4 — CID 23209403
5,6-dibromo-5,6-dimethylcyclohexa-1,3-diene-1,4-dicarboxylic acid (PubChem CID 23209403) has the molecular formula C10H10Br2O4 and a molecular weight of 353.99 g/mol. Its IUPAC name is 5,6-dibromo-5,6-dimethylcyclohexa-1,3-diene-1,4-dicarboxylic acid.
| Compound Name | 5,6-dibromo-5,6-dimethylcyclohexa-1,3-diene-1,4-dicarboxylic acid |
|---|---|
| PubChem CID | 23209403 |
| Molecular Formula | C10H10Br2O4 |
| Molecular Weight | 353.99 g/mol |
| Exact Mass | 351.89 |
| IUPAC Name | 5,6-dibromo-5,6-dimethylcyclohexa-1,3-diene-1,4-dicarboxylic acid |
| SMILES | CC1(Br)C(C(=O)O)=CC=C(C(=O)O)C1(C)Br |
| InChI | InChI=1S/C10H10Br2O4/c1-9(11)5(7(13)14)3-4-6(8(15)16)10(9,2)12/h3-4H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | DECALQKGHVUOCV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.99 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|