About N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide
N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (PubChem CID 23209666) has the molecular formula C18H16F3N3O2S
and a molecular weight of 395.41 g/mol. Its IUPAC name is N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
Molecular Properties
| Compound Name | N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| PubChem CID | 23209666 |
| Molecular Formula | C18H16F3N3O2S |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.09 |
| IUPAC Name | N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nn2NS(=O)(=O)c2ccccc2)c(C)c1 |
| InChI | InChI=1S/C18H16F3N3O2S/c1-12-8-9-15(13(2)10-12)16-11-17(18(19,20)21)22-24(16)23-27(25,26)14-6-4-3-5-7-14/h3-11,23H,1-2H3 |
| InChIKey | JCJXPPDBRJNGAD-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The IUPAC name of N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide (CID 23209666) is N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide.
What is the SMILES notation for N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The canonical SMILES for N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide is Cc1ccc(-c2cc(C(F)(F)F)nn2NS(=O)(=O)c2ccccc2)c(C)c1.
What is the InChIKey of N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
The InChIKey is JCJXPPDBRJNGAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16F3N3O2S/c1-12-8-9-15(13(2)10-12)16-11-17(18(19,20)21)22-24(16)23-27(25,26)14-6-4-3-5-7-14/h3-11,23H,1-2H3.
What are the key properties of N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide?
N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide has a molecular weight of 395.41 g/mol, XLogP of 4.12, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(2,4-dimethylphenyl)-3-(trifluoromethyl)pyrazol-1-yl]benzenesulfonamide is sourced from PubChem (CID 23209666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).