About 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid
4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid (PubChem CID 23210615) has the molecular formula C18H12BrNO2S
and a molecular weight of 386.27 g/mol. Its IUPAC name is 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid.
Molecular Properties
| Compound Name | 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid |
| PubChem CID | 23210615 |
| Molecular Formula | C18H12BrNO2S |
| Molecular Weight | 386.27 g/mol |
| Exact Mass | 384.98 |
| IUPAC Name | 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid |
| SMILES | O=C(O)c1cc2c3cc(Br)ccc3n(Cc3ccccc3)c2s1 |
| InChI | InChI=1S/C18H12BrNO2S/c19-12-6-7-15-13(8-12)14-9-16(18(21)22)23-17(14)20(15)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,21,22) |
| InChIKey | OHXHOJDBJKQOGJ-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 386.27 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid?
The IUPAC name of 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid (CID 23210615) is 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid.
What is the SMILES notation for 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid?
The canonical SMILES for 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid is O=C(O)c1cc2c3cc(Br)ccc3n(Cc3ccccc3)c2s1.
What is the InChIKey of 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid?
The InChIKey is OHXHOJDBJKQOGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H12BrNO2S/c19-12-6-7-15-13(8-12)14-9-16(18(21)22)23-17(14)20(15)10-11-4-2-1-3-5-11/h1-9H,10H2,(H,21,22).
What are the key properties of 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid?
4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid has a molecular weight of 386.27 g/mol, XLogP of 5.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzyl-7-bromothieno[2,3-b]indole-2-carboxylic acid is sourced from PubChem (CID 23210615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).