C29H40N2O3 — CID 23211772
N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide (PubChem CID 23211772) has the molecular formula C29H40N2O3 and a molecular weight of 464.65 g/mol. Its IUPAC name is N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide.
| Compound Name | N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide |
|---|---|
| PubChem CID | 23211772 |
| Molecular Formula | C29H40N2O3 |
| Molecular Weight | 464.65 g/mol |
| Exact Mass | 464.30 |
| IUPAC Name | N-[4a-(3-hydroxyphenyl)-8a-methoxy-2-methyl-3,4,5,6,7,8-hexahydro-1H-isoquinolin-6-yl]-6-phenylhexanamide |
| SMILES | COC12CCC(NC(=O)CCCCCc3ccccc3)CC1(c1cccc(O)c1)CCN(C)C2 |
| InChI | InChI=1S/C29H40N2O3/c1-31-19-18-28(24-13-9-14-26(32)20-24)21-25(16-17-29(28,22-31)34-2)30-27(33)15-8-4-7-12-23-10-5-3-6-11-23/h3,5-6,9-11,13-14,20,25,32H,4,7-8,12,15-19,21-22H2,1-2H3,(H,30,33) |
| InChIKey | SRSKHVFDRRJZBH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.65 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|