C21H26F17N2O6P — CID 23211908
6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl dimorpholin-4-yl phosphate (PubChem CID 23211908) has the molecular formula C21H26F17N2O6P and a molecular weight of 756.39 g/mol. Its IUPAC name is 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl dimorpholin-4-yl phosphate.
| Compound Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl dimorpholin-4-yl phosphate |
|---|---|
| PubChem CID | 23211908 |
| Molecular Formula | C21H26F17N2O6P |
| Molecular Weight | 756.39 g/mol |
| Exact Mass | 756.13 |
| IUPAC Name | 6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,13-heptadecafluorotridecyl dimorpholin-4-yl phosphate |
| SMILES | O=P(OCCCCCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)(ON1CCOCC1)ON1CCOCC1 |
| InChI | InChI=1S/C21H26F17N2O6P/c22-14(23,15(24,25)16(26,27)17(28,29)18(30,31)19(32,33)20(34,35)21(36,37)38)4-2-1-3-9-44-47(41,45-39-5-10-42-11-6-39)46-40-7-12-43-13-8-40/h1-13H2 |
| InChIKey | OBRGKIQZVGATGU-UHFFFAOYSA-N |
| XLogP | 7.21 |
| TPSA | 69.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.39 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|