About 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate
2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate (PubChem CID 23212003) has the molecular formula C24H17O7S3-
and a molecular weight of 513.59 g/mol. Its IUPAC name is 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate.
Molecular Properties
| Compound Name | 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate |
| PubChem CID | 23212003 |
| Molecular Formula | C24H17O7S3- |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.01 |
| IUPAC Name | 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate |
| SMILES | O=S(=O)([O-])c1ccccc1-c1ccc(S(=O)(=O)c2ccccc2)cc1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C24H18O7S3/c25-32(26,18-9-3-1-4-10-18)20-15-16-22(21-13-7-8-14-23(21)34(29,30)31)24(17-20)33(27,28)19-11-5-2-6-12-19/h1-17H,(H,29,30,31)/p-1 |
| InChIKey | SPXDWZBEOZYXFV-UHFFFAOYSA-M |
| XLogP | 3.92 |
| TPSA | 125.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate?
The IUPAC name of 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate (CID 23212003) is 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate.
What is the SMILES notation for 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate?
The canonical SMILES for 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate is O=S(=O)([O-])c1ccccc1-c1ccc(S(=O)(=O)c2ccccc2)cc1S(=O)(=O)c1ccccc1.
What is the InChIKey of 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate?
The InChIKey is SPXDWZBEOZYXFV-UHFFFAOYSA-M. The full InChI is InChI=1S/C24H18O7S3/c25-32(26,18-9-3-1-4-10-18)20-15-16-22(21-13-7-8-14-23(21)34(29,30)31)24(17-20)33(27,28)19-11-5-2-6-12-19/h1-17H,(H,29,30,31)/p-1.
What are the key properties of 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate?
2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate has a molecular weight of 513.59 g/mol, XLogP of 3.92, 6 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4-bis(benzenesulfonyl)phenyl]benzenesulfonate is sourced from PubChem (CID 23212003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).