C17H29N5O8 — CID 23212206
2-[6,12-bis(carboxymethyl)-2-ethyl-4,14-dioxo-1,3,6,9,12-pentazacyclotetradec-9-yl]acetic acid (PubChem CID 23212206) has the molecular formula C17H29N5O8 and a molecular weight of 431.45 g/mol. Its IUPAC name is 2-[6,12-bis(carboxymethyl)-2-ethyl-4,14-dioxo-1,3,6,9,12-pentazacyclotetradec-9-yl]acetic acid.
| Compound Name | 2-[6,12-bis(carboxymethyl)-2-ethyl-4,14-dioxo-1,3,6,9,12-pentazacyclotetradec-9-yl]acetic acid |
|---|---|
| PubChem CID | 23212206 |
| Molecular Formula | C17H29N5O8 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 2-[6,12-bis(carboxymethyl)-2-ethyl-4,14-dioxo-1,3,6,9,12-pentazacyclotetradec-9-yl]acetic acid |
| SMILES | CCC1NC(=O)CN(CC(=O)O)CCN(CC(=O)O)CCN(CC(=O)O)CC(=O)N1 |
| InChI | InChI=1S/C17H29N5O8/c1-2-12-18-13(23)7-21(10-16(27)28)5-3-20(9-15(25)26)4-6-22(11-17(29)30)8-14(24)19-12/h12H,2-11H2,1H3,(H,18,23)(H,19,24)(H,25,26)(H,27,28)(H,29,30) |
| InChIKey | VIBJITXPFISLHW-UHFFFAOYSA-N |
| XLogP | -2.87 |
| TPSA | 179.82 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | -2.87 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |