About 1,3-difluoroisoquinoline
1,3-difluoroisoquinoline (PubChem CID 23213311) has the molecular formula C9H5F2N
and a molecular weight of 165.14 g/mol. Its IUPAC name is 1,3-difluoroisoquinoline.
Molecular Properties
| Compound Name | 1,3-difluoroisoquinoline |
| PubChem CID | 23213311 |
| Molecular Formula | C9H5F2N |
| Molecular Weight | 165.14 g/mol |
| Exact Mass | 165.04 |
| IUPAC Name | 1,3-difluoroisoquinoline |
| SMILES | Fc1cc2ccccc2c(F)n1 |
| InChI | InChI=1S/C9H5F2N/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H |
| InChIKey | YUUGFARVOSOCLZ-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.14 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 1,3-difluoroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-difluoroisoquinoline?
The IUPAC name of 1,3-difluoroisoquinoline (CID 23213311) is 1,3-difluoroisoquinoline.
What is the SMILES notation for 1,3-difluoroisoquinoline?
The canonical SMILES for 1,3-difluoroisoquinoline is Fc1cc2ccccc2c(F)n1.
What is the InChIKey of 1,3-difluoroisoquinoline?
The InChIKey is YUUGFARVOSOCLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5F2N/c10-8-5-6-3-1-2-4-7(6)9(11)12-8/h1-5H.
What are the key properties of 1,3-difluoroisoquinoline?
1,3-difluoroisoquinoline has a molecular weight of 165.14 g/mol, XLogP of 2.51, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-difluoroisoquinoline is sourced from PubChem (CID 23213311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).