C30H43F3N2O2 — CID 23213322
1,8,8-trifluoro-3-octoxy-4-(5-octoxy-2-pyridinyl)-6,7-dihydro-5H-isoquinoline (PubChem CID 23213322) has the molecular formula C30H43F3N2O2 and a molecular weight of 520.68 g/mol. Its IUPAC name is 1,8,8-trifluoro-3-octoxy-4-(5-octoxy-2-pyridinyl)-6,7-dihydro-5H-isoquinoline.
| Compound Name | 1,8,8-trifluoro-3-octoxy-4-(5-octoxy-2-pyridinyl)-6,7-dihydro-5H-isoquinoline |
|---|---|
| PubChem CID | 23213322 |
| Molecular Formula | C30H43F3N2O2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.33 |
| IUPAC Name | 1,8,8-trifluoro-3-octoxy-4-(5-octoxy-2-pyridinyl)-6,7-dihydro-5H-isoquinoline |
| SMILES | CCCCCCCCOc1ccc(-c2c(OCCCCCCCC)nc(F)c3c2CCCC3(F)F)nc1 |
| InChI | InChI=1S/C30H43F3N2O2/c1-3-5-7-9-11-13-20-36-23-17-18-25(34-22-23)26-24-16-15-19-30(32,33)27(24)28(31)35-29(26)37-21-14-12-10-8-6-4-2/h17-18,22H,3-16,19-21H2,1-2H3 |
| InChIKey | QMAOVTUXGLFYLE-UHFFFAOYSA-N |
| XLogP | 9.19 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|