C20H20N4O2S — CID 2321335
2-(3-piperidin-1-ylsulfonylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole (PubChem CID 2321335) has the molecular formula C20H20N4O2S and a molecular weight of 380.47 g/mol. Its IUPAC name is 2-(3-piperidin-1-ylsulfonylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole.
| Compound Name | 2-(3-piperidin-1-ylsulfonylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole |
|---|---|
| PubChem CID | 2321335 |
| Molecular Formula | C20H20N4O2S |
| Molecular Weight | 380.47 g/mol |
| Exact Mass | 380.13 |
| IUPAC Name | 2-(3-piperidin-1-ylsulfonylphenyl)-5H-[1,2,4]triazolo[5,1-a]isoindole |
| SMILES | O=S(=O)(c1cccc(-c2nc3n(n2)Cc2ccccc2-3)c1)N1CCCCC1 |
| InChI | InChI=1S/C20H20N4O2S/c25-27(26,23-11-4-1-5-12-23)17-9-6-8-15(13-17)19-21-20-18-10-3-2-7-16(18)14-24(20)22-19/h2-3,6-10,13H,1,4-5,11-12,14H2 |
| InChIKey | IKJKIIOFXROKPM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.47 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |