About acetonitrile;biphenylene
acetonitrile;biphenylene (PubChem CID 23213528) has the molecular formula C14H11N
and a molecular weight of 193.25 g/mol. Its IUPAC name is acetonitrile;biphenylene.
Molecular Properties
| Compound Name | acetonitrile;biphenylene |
| PubChem CID | 23213528 |
| Molecular Formula | C14H11N |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | acetonitrile;biphenylene |
| SMILES | CC#N.c1ccc2c(c1)-c1ccccc1-2 |
| InChI | InChI=1S/C12H8.C2H3N/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-2-3/h1-8H;1H3 |
| InChIKey | YTWSADIVXQJSJH-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze acetonitrile;biphenylene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;biphenylene?
The IUPAC name of acetonitrile;biphenylene (CID 23213528) is acetonitrile;biphenylene.
What is the SMILES notation for acetonitrile;biphenylene?
The canonical SMILES for acetonitrile;biphenylene is CC#N.c1ccc2c(c1)-c1ccccc1-2.
What is the InChIKey of acetonitrile;biphenylene?
The InChIKey is YTWSADIVXQJSJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8.C2H3N/c1-2-6-10-9(5-1)11-7-3-4-8-12(10)11;1-2-3/h1-8H;1H3.
What are the key properties of acetonitrile;biphenylene?
acetonitrile;biphenylene has a molecular weight of 193.25 g/mol, XLogP of 3.86, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;biphenylene is sourced from PubChem (CID 23213528), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).