C20H21F3N4O3S — CID 23213587
2-[5-(ethanethioylamino)-6-oxo-2-phenylpyrimidin-1-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide (PubChem CID 23213587) has the molecular formula C20H21F3N4O3S and a molecular weight of 454.47 g/mol. Its IUPAC name is 2-[5-(ethanethioylamino)-6-oxo-2-phenylpyrimidin-1-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide.
| Compound Name | 2-[5-(ethanethioylamino)-6-oxo-2-phenylpyrimidin-1-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide |
|---|---|
| PubChem CID | 23213587 |
| Molecular Formula | C20H21F3N4O3S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.13 |
| IUPAC Name | 2-[5-(ethanethioylamino)-6-oxo-2-phenylpyrimidin-1-yl]-N-(1,1,1-trifluoro-4-methyl-2-oxopentan-3-yl)acetamide |
| SMILES | CC(=S)Nc1cnc(-c2ccccc2)n(CC(=O)NC(C(=O)C(F)(F)F)C(C)C)c1=O |
| InChI | InChI=1S/C20H21F3N4O3S/c1-11(2)16(17(29)20(21,22)23)26-15(28)10-27-18(13-7-5-4-6-8-13)24-9-14(19(27)30)25-12(3)31/h4-9,11,16H,10H2,1-3H3,(H,25,31)(H,26,28) |
| InChIKey | DADZRYOTGGRMLS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 93.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|