C29H42N2O8 — CID 23214254
1-hydroxy-3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-pentylurea (PubChem CID 23214254) has the molecular formula C29H42N2O8 and a molecular weight of 546.66 g/mol. Its IUPAC name is 1-hydroxy-3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-pentylurea.
| Compound Name | 1-hydroxy-3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-pentylurea |
|---|---|
| PubChem CID | 23214254 |
| Molecular Formula | C29H42N2O8 |
| Molecular Weight | 546.66 g/mol |
| Exact Mass | 546.29 |
| IUPAC Name | 1-hydroxy-3-[3-methoxy-2-propoxy-5-[5-(3,4,5-trimethoxyphenyl)oxolan-2-yl]phenyl]-1-pentylurea |
| SMILES | CCCCCN(O)C(=O)Nc1cc(C2CCC(c3cc(OC)c(OC)c(OC)c3)O2)cc(OC)c1OCCC |
| InChI | InChI=1S/C29H42N2O8/c1-7-9-10-13-31(33)29(32)30-21-15-19(16-24(34-3)27(21)38-14-8-2)22-11-12-23(39-22)20-17-25(35-4)28(37-6)26(18-20)36-5/h15-18,22-23,33H,7-14H2,1-6H3,(H,30,32) |
| InChIKey | GJSQGLBQSRTUGY-UHFFFAOYSA-N |
| XLogP | 6.52 |
| TPSA | 107.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.66 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|