C27H29F6NO3 — CID 23214947
butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxymethyl]-4-phenylpiperidine-1-carboxylate (PubChem CID 23214947) has the molecular formula C27H29F6NO3 and a molecular weight of 529.52 g/mol. Its IUPAC name is butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxymethyl]-4-phenylpiperidine-1-carboxylate.
| Compound Name | butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxymethyl]-4-phenylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 23214947 |
| Molecular Formula | C27H29F6NO3 |
| Molecular Weight | 529.52 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | butyl 4-[1-[3,5-bis(trifluoromethyl)phenyl]ethenoxymethyl]-4-phenylpiperidine-1-carboxylate |
| SMILES | C=C(OCC1(c2ccccc2)CCN(C(=O)OCCCC)CC1)c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H29F6NO3/c1-3-4-14-36-24(35)34-12-10-25(11-13-34,21-8-6-5-7-9-21)18-37-19(2)20-15-22(26(28,29)30)17-23(16-20)27(31,32)33/h5-9,15-17H,2-4,10-14,18H2,1H3 |
| InChIKey | VZVPJXNESUMXAM-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.52 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|