About 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline
6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline (PubChem CID 23215466) has the molecular formula C11H16FN
and a molecular weight of 181.25 g/mol. Its IUPAC name is 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline.
Analyze 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline?
The IUPAC name of 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline (CID 23215466) is 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline.
What is the SMILES notation for 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline?
The canonical SMILES for 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline is CC1CCC2=C(C=CC(C)(F)C2)N1.
What is the InChIKey of 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline?
The InChIKey is HVHYTFYAWRXKMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16FN/c1-8-3-4-9-7-11(2,12)6-5-10(9)13-8/h5-6,8,13H,3-4,7H2,1-2H3.
What are the key properties of 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline?
6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline has a molecular weight of 181.25 g/mol, XLogP of 2.70, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-fluoro-2,6-dimethyl-2,3,4,5-tetrahydro-1H-quinoline is sourced from PubChem (CID 23215466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).