C12H19FO2 — CID 23215678
[3-fluoro-4-(hydroxymethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]methanol (PubChem CID 23215678) has the molecular formula C12H19FO2 and a molecular weight of 214.28 g/mol. Its IUPAC name is [3-fluoro-4-(hydroxymethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]methanol.
| Compound Name | [3-fluoro-4-(hydroxymethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]methanol |
|---|---|
| PubChem CID | 23215678 |
| Molecular Formula | C12H19FO2 |
| Molecular Weight | 214.28 g/mol |
| Exact Mass | 214.14 |
| IUPAC Name | [3-fluoro-4-(hydroxymethyl)-1,2,3,4,4a,5,8,8a-octahydronaphthalen-1-yl]methanol |
| SMILES | OCC1CC(F)C(CO)C2CC=CCC12 |
| InChI | InChI=1S/C12H19FO2/c13-12-5-8(6-14)9-3-1-2-4-10(9)11(12)7-15/h1-2,8-12,14-15H,3-7H2 |
| InChIKey | YDJDYVGIBKSKJK-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|