About (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate
(2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate (PubChem CID 23216229) has the molecular formula C5H4N2O5
and a molecular weight of 172.10 g/mol. Its IUPAC name is (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate.
Molecular Properties
| Compound Name | (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate |
| PubChem CID | 23216229 |
| Molecular Formula | C5H4N2O5 |
| Molecular Weight | 172.10 g/mol |
| Exact Mass | 172.01 |
| IUPAC Name | (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate |
| SMILES | O=C(O)Oc1c[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C5H4N2O5/c8-3-2(12-5(10)11)1-6-4(9)7-3/h1H,(H,10,11)(H2,6,7,8,9) |
| InChIKey | LDFRYOHVSASURT-UHFFFAOYSA-N |
| XLogP | -0.88 |
| TPSA | 112.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.10 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate?
The IUPAC name of (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate (CID 23216229) is (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate.
What is the SMILES notation for (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate?
The canonical SMILES for (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate is O=C(O)Oc1c[nH]c(=O)[nH]c1=O.
What is the InChIKey of (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate?
The InChIKey is LDFRYOHVSASURT-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H4N2O5/c8-3-2(12-5(10)11)1-6-4(9)7-3/h1H,(H,10,11)(H2,6,7,8,9).
What are the key properties of (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate?
(2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate has a molecular weight of 172.10 g/mol, XLogP of -0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2,4-dioxo-1H-pyrimidin-5-yl) hydrogen carbonate is sourced from PubChem (CID 23216229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).