About N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide
N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide (PubChem CID 23216327) has the molecular formula C9H21N3O2
and a molecular weight of 203.29 g/mol. Its IUPAC name is N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide.
Molecular Properties
| Compound Name | N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide |
| PubChem CID | 23216327 |
| Molecular Formula | C9H21N3O2 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide |
| SMILES | C/C(N)=N\CCCCC(N)C(O)CO |
| InChI | InChI=1S/C9H21N3O2/c1-7(10)12-5-3-2-4-8(11)9(14)6-13/h8-9,13-14H,2-6,11H2,1H3,(H2,10,12) |
| InChIKey | SWFGZPKOOOLHNM-UHFFFAOYSA-N |
| XLogP | -0.79 |
| TPSA | 104.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide?
The IUPAC name of N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide (CID 23216327) is N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide.
What is the SMILES notation for N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide?
The canonical SMILES for N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide is C/C(N)=N\CCCCC(N)C(O)CO.
What is the InChIKey of N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide?
The InChIKey is SWFGZPKOOOLHNM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3O2/c1-7(10)12-5-3-2-4-8(11)9(14)6-13/h8-9,13-14H,2-6,11H2,1H3,(H2,10,12).
What are the key properties of N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide?
N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide has a molecular weight of 203.29 g/mol, XLogP of -0.79, 7 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(5-amino-6,7-dihydroxyheptyl)ethanimidamide is sourced from PubChem (CID 23216327), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).