About N,N-dibenzyl-2,6-difluorobenzamide
N,N-dibenzyl-2,6-difluorobenzamide (PubChem CID 2321718) has the molecular formula C21H17F2NO
and a molecular weight of 337.37 g/mol. Its IUPAC name is N,N-dibenzyl-2,6-difluorobenzamide.
Molecular Properties
| Compound Name | N,N-dibenzyl-2,6-difluorobenzamide |
| PubChem CID | 2321718 |
| Molecular Formula | C21H17F2NO |
| Molecular Weight | 337.37 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | N,N-dibenzyl-2,6-difluorobenzamide |
| SMILES | O=C(c1c(F)cccc1F)N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H17F2NO/c22-18-12-7-13-19(23)20(18)21(25)24(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-13H,14-15H2 |
| InChIKey | CAHHPOXZQLDBDV-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.37 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N,N-dibenzyl-2,6-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-dibenzyl-2,6-difluorobenzamide?
The IUPAC name of N,N-dibenzyl-2,6-difluorobenzamide (CID 2321718) is N,N-dibenzyl-2,6-difluorobenzamide.
What is the SMILES notation for N,N-dibenzyl-2,6-difluorobenzamide?
The canonical SMILES for N,N-dibenzyl-2,6-difluorobenzamide is O=C(c1c(F)cccc1F)N(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of N,N-dibenzyl-2,6-difluorobenzamide?
The InChIKey is CAHHPOXZQLDBDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17F2NO/c22-18-12-7-13-19(23)20(18)21(25)24(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-13H,14-15H2.
What are the key properties of N,N-dibenzyl-2,6-difluorobenzamide?
N,N-dibenzyl-2,6-difluorobenzamide has a molecular weight of 337.37 g/mol, XLogP of 4.81, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-dibenzyl-2,6-difluorobenzamide is sourced from PubChem (CID 2321718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).