C19H12F3NO4S — CID 23217219
N-[6-(3,4,5-trifluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide (PubChem CID 23217219) has the molecular formula C19H12F3NO4S and a molecular weight of 407.37 g/mol. Its IUPAC name is N-[6-(3,4,5-trifluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide.
| Compound Name | N-[6-(3,4,5-trifluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 23217219 |
| Molecular Formula | C19H12F3NO4S |
| Molecular Weight | 407.37 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-[6-(3,4,5-trifluorophenyl)-1,3-benzodioxol-5-yl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1cc2c(cc1-c1cc(F)c(F)c(F)c1)OCO2)c1ccccc1 |
| InChI | InChI=1S/C19H12F3NO4S/c20-14-6-11(7-15(21)19(14)22)13-8-17-18(27-10-26-17)9-16(13)23-28(24,25)12-4-2-1-3-5-12/h1-9,23H,10H2 |
| InChIKey | QOTWMBVNJYNIRE-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.37 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|