C24H23N3O2S — CID 2321734
(5S,10bR)-5-(4-morpholin-4-ylphenyl)-2-thiophen-2-yl-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine (PubChem CID 2321734) has the molecular formula C24H23N3O2S and a molecular weight of 417.53 g/mol. Its IUPAC name is (5S,10bR)-5-(4-morpholin-4-ylphenyl)-2-thiophen-2-yl-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine.
| Compound Name | (5S,10bR)-5-(4-morpholin-4-ylphenyl)-2-thiophen-2-yl-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine |
|---|---|
| PubChem CID | 2321734 |
| Molecular Formula | C24H23N3O2S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.15 |
| IUPAC Name | (5S,10bR)-5-(4-morpholin-4-ylphenyl)-2-thiophen-2-yl-5,10b-dihydro-3H-pyrazolo[1,5-c][1,3]benzoxazine |
| SMILES | C1=C(c2cccs2)NN2[C@H]1c1ccccc1O[C@H]2c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C24H23N3O2S/c1-2-5-22-19(4-1)21-16-20(23-6-3-15-30-23)25-27(21)24(29-22)17-7-9-18(10-8-17)26-11-13-28-14-12-26/h1-10,15-16,21,24-25H,11-14H2/t21-,24+/m1/s1 |
| InChIKey | OAXSFQBZVZZAQT-QPPBQGQZSA-N |
| XLogP | 4.58 |
| TPSA | 36.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|