About 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide
2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide (PubChem CID 23217422) has the molecular formula C20H18ClNO4S
and a molecular weight of 403.89 g/mol. Its IUPAC name is 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide.
Molecular Properties
| Compound Name | 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide |
| PubChem CID | 23217422 |
| Molecular Formula | C20H18ClNO4S |
| Molecular Weight | 403.89 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide |
| SMILES | COc1cc(-c2ccccc2-c2ccccc2S(N)(=O)=O)cc(OC)c1Cl |
| InChI | InChI=1S/C20H18ClNO4S/c1-25-17-11-13(12-18(26-2)20(17)21)14-7-3-4-8-15(14)16-9-5-6-10-19(16)27(22,23)24/h3-12H,1-2H3,(H2,22,23,24) |
| InChIKey | NABWCABBIHCMGB-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.89 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide?
The IUPAC name of 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide (CID 23217422) is 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide.
What is the SMILES notation for 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide?
The canonical SMILES for 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide is COc1cc(-c2ccccc2-c2ccccc2S(N)(=O)=O)cc(OC)c1Cl.
What is the InChIKey of 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide?
The InChIKey is NABWCABBIHCMGB-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18ClNO4S/c1-25-17-11-13(12-18(26-2)20(17)21)14-7-3-4-8-15(14)16-9-5-6-10-19(16)27(22,23)24/h3-12H,1-2H3,(H2,22,23,24).
What are the key properties of 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide?
2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide has a molecular weight of 403.89 g/mol, XLogP of 4.34, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(4-chloro-3,5-dimethoxyphenyl)phenyl]benzenesulfonamide is sourced from PubChem (CID 23217422), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).