About 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide
4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide (PubChem CID 23217522) has the molecular formula C20H10F9NO2S
and a molecular weight of 499.35 g/mol. Its IUPAC name is 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide.
Molecular Properties
| Compound Name | 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide |
| PubChem CID | 23217522 |
| Molecular Formula | C20H10F9NO2S |
| Molecular Weight | 499.35 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccccc1)c1cc(F)c(F)cc1-c1cc(C(F)(F)F)c(F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C20H10F9NO2S/c21-15-8-12(10-6-13(19(24,25)26)18(23)14(7-10)20(27,28)29)17(9-16(15)22)33(31,32)30-11-4-2-1-3-5-11/h1-9,30H |
| InChIKey | PUQIHBGWCNVVJC-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.35 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide?
The IUPAC name of 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide (CID 23217522) is 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide.
What is the SMILES notation for 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide?
The canonical SMILES for 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide is O=S(=O)(Nc1ccccc1)c1cc(F)c(F)cc1-c1cc(C(F)(F)F)c(F)c(C(F)(F)F)c1.
What is the InChIKey of 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide?
The InChIKey is PUQIHBGWCNVVJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H10F9NO2S/c21-15-8-12(10-6-13(19(24,25)26)18(23)14(7-10)20(27,28)29)17(9-16(15)22)33(31,32)30-11-4-2-1-3-5-11/h1-9,30H.
What are the key properties of 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide?
4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide has a molecular weight of 499.35 g/mol, XLogP of 6.61, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-difluoro-2-[4-fluoro-3,5-bis(trifluoromethyl)phenyl]-N-phenylbenzenesulfonamide is sourced from PubChem (CID 23217522), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).