About ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate
ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate (PubChem CID 23218115) has the molecular formula C13H19N3S
and a molecular weight of 249.38 g/mol. Its IUPAC name is ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate.
Molecular Properties
| Compound Name | ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate |
| PubChem CID | 23218115 |
| Molecular Formula | C13H19N3S |
| Molecular Weight | 249.38 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate |
| SMILES | CCS/C(N)=N\c1ccc2c(c1)CN(C)CC2 |
| InChI | InChI=1S/C13H19N3S/c1-3-17-13(14)15-12-5-4-10-6-7-16(2)9-11(10)8-12/h4-5,8H,3,6-7,9H2,1-2H3,(H2,14,15) |
| InChIKey | QCCXSQAJJJPYSZ-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.38 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate?
The IUPAC name of ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate (CID 23218115) is ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate.
What is the SMILES notation for ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate?
The canonical SMILES for ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate is CCS/C(N)=N\c1ccc2c(c1)CN(C)CC2.
What is the InChIKey of ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate?
The InChIKey is QCCXSQAJJJPYSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3S/c1-3-17-13(14)15-12-5-4-10-6-7-16(2)9-11(10)8-12/h4-5,8H,3,6-7,9H2,1-2H3,(H2,14,15).
What are the key properties of ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate?
ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate has a molecular weight of 249.38 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N'-(2-methyl-3,4-dihydro-1H-isoquinolin-7-yl)carbamimidothioate is sourced from PubChem (CID 23218115), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).