C42H84N6 — CID 23218484
N,N',1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine (PubChem CID 23218484) has the molecular formula C42H84N6 and a molecular weight of 673.18 g/mol. Its IUPAC name is N,N',1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine.
| Compound Name | N,N',1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
|---|---|
| PubChem CID | 23218484 |
| Molecular Formula | C42H84N6 |
| Molecular Weight | 673.18 g/mol |
| Exact Mass | 672.68 |
| IUPAC Name | N,N',1,1-tetrakis(2,2,6,6-tetramethylpiperidin-4-yl)hexane-1,6-diamine |
| SMILES | CC1(C)CC(NCCCCCC(NC2CC(C)(C)NC(C)(C)C2)(C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C42H84N6/c1-34(2)22-30(23-35(3,4)45-34)42(31-24-36(5,6)46-37(7,8)25-31,44-33-28-40(13,14)48-41(15,16)29-33)20-18-17-19-21-43-32-26-38(9,10)47-39(11,12)27-32/h30-33,43-48H,17-29H2,1-16H3 |
| InChIKey | UEAMYGSHAKWYKH-UHFFFAOYSA-N |
| XLogP | 8.20 |
| TPSA | 72.18 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.18 |
| LogP ≤ 5 | 8.20 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|