C16H16ClNO2 — CID 23219702
4-[(4-chlorophenyl)methoxy]-2,3-dimethylbenzamide (PubChem CID 23219702) has the molecular formula C16H16ClNO2 and a molecular weight of 289.76 g/mol. Its IUPAC name is 4-[(4-chlorophenyl)methoxy]-2,3-dimethylbenzamide.
| Compound Name | 4-[(4-chlorophenyl)methoxy]-2,3-dimethylbenzamide |
|---|---|
| PubChem CID | 23219702 |
| Molecular Formula | C16H16ClNO2 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 4-[(4-chlorophenyl)methoxy]-2,3-dimethylbenzamide |
| SMILES | Cc1c(OCc2ccc(Cl)cc2)ccc(C(N)=O)c1C |
| InChI | InChI=1S/C16H16ClNO2/c1-10-11(2)15(8-7-14(10)16(18)19)20-9-12-3-5-13(17)6-4-12/h3-8H,9H2,1-2H3,(H2,18,19) |
| InChIKey | NZQSQZOMIUEOPV-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |