About 1-benzhydryltriazole
1-benzhydryltriazole (PubChem CID 23220724) has the molecular formula C15H13N3
and a molecular weight of 235.29 g/mol. Its IUPAC name is 1-benzhydryltriazole.
Molecular Properties
| Compound Name | 1-benzhydryltriazole |
| PubChem CID | 23220724 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 1-benzhydryltriazole |
| SMILES | c1ccc(C(c2ccccc2)n2ccnn2)cc1 |
| InChI | InChI=1S/C15H13N3/c1-3-7-13(8-4-1)15(18-12-11-16-17-18)14-9-5-2-6-10-14/h1-12,15H |
| InChIKey | FNOTUCMOXQMXKW-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-benzhydryltriazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzhydryltriazole?
The IUPAC name of 1-benzhydryltriazole (CID 23220724) is 1-benzhydryltriazole.
What is the SMILES notation for 1-benzhydryltriazole?
The canonical SMILES for 1-benzhydryltriazole is c1ccc(C(c2ccccc2)n2ccnn2)cc1.
What is the InChIKey of 1-benzhydryltriazole?
The InChIKey is FNOTUCMOXQMXKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13N3/c1-3-7-13(8-4-1)15(18-12-11-16-17-18)14-9-5-2-6-10-14/h1-12,15H.
What are the key properties of 1-benzhydryltriazole?
1-benzhydryltriazole has a molecular weight of 235.29 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzhydryltriazole is sourced from PubChem (CID 23220724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).