About [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate
[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate (PubChem CID 23222802) has the molecular formula C24H28N2O2S
and a molecular weight of 408.57 g/mol. Its IUPAC name is [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate.
Molecular Properties
| Compound Name | [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate |
| PubChem CID | 23222802 |
| Molecular Formula | C24H28N2O2S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.19 |
| IUPAC Name | [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate |
| SMILES | CCCC(=O)Oc1cnc(C#Cc2cc3c(cc2C)SCCC3(CC)CC)cn1 |
| InChI | InChI=1S/C24H28N2O2S/c1-5-8-23(27)28-22-16-25-19(15-26-22)10-9-18-14-20-21(13-17(18)4)29-12-11-24(20,6-2)7-3/h13-16H,5-8,11-12H2,1-4H3 |
| InChIKey | NSZFTGARPLOHNI-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate?
The IUPAC name of [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate (CID 23222802) is [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate.
What is the SMILES notation for [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate?
The canonical SMILES for [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate is CCCC(=O)Oc1cnc(C#Cc2cc3c(cc2C)SCCC3(CC)CC)cn1.
What is the InChIKey of [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate?
The InChIKey is NSZFTGARPLOHNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H28N2O2S/c1-5-8-23(27)28-22-16-25-19(15-26-22)10-9-18-14-20-21(13-17(18)4)29-12-11-24(20,6-2)7-3/h13-16H,5-8,11-12H2,1-4H3.
What are the key properties of [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate?
[5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate has a molecular weight of 408.57 g/mol, XLogP of 5.44, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [5-[2-(4,4-diethyl-7-methyl-2,3-dihydrothiochromen-6-yl)ethynyl]pyrazin-2-yl] butanoate is sourced from PubChem (CID 23222802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).