C11H17ClN2OS — CID 23223053
2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,3-thiazole;hydrochloride (PubChem CID 23223053) has the molecular formula C11H17ClN2OS and a molecular weight of 260.79 g/mol. Its IUPAC name is 2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,3-thiazole;hydrochloride.
| Compound Name | 2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 23223053 |
| Molecular Formula | C11H17ClN2OS |
| Molecular Weight | 260.79 g/mol |
| Exact Mass | 260.08 |
| IUPAC Name | 2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1csc(OCC23CCCN2CCC3)n1 |
| InChI | InChI=1S/C11H16N2OS.ClH/c1-3-11(4-2-7-13(11)6-1)9-14-10-12-5-8-15-10;/h5,8H,1-4,6-7,9H2;1H |
| InChIKey | BEBCDLMMYMXUDV-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.79 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |