About 2-(pyridin-2-ylmethyl)-1,3-benzothiazole
2-(pyridin-2-ylmethyl)-1,3-benzothiazole (PubChem CID 2322343) has the molecular formula C13H10N2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 2-(pyridin-2-ylmethyl)-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-(pyridin-2-ylmethyl)-1,3-benzothiazole |
| PubChem CID | 2322343 |
| Molecular Formula | C13H10N2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.06 |
| IUPAC Name | 2-(pyridin-2-ylmethyl)-1,3-benzothiazole |
| SMILES | c1ccc(Cc2nc3ccccc3s2)nc1 |
| InChI | InChI=1S/C13H10N2S/c1-2-7-12-11(6-1)15-13(16-12)9-10-5-3-4-8-14-10/h1-8H,9H2 |
| InChIKey | IYVPJYAPIITGLH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(pyridin-2-ylmethyl)-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(pyridin-2-ylmethyl)-1,3-benzothiazole?
The IUPAC name of 2-(pyridin-2-ylmethyl)-1,3-benzothiazole (CID 2322343) is 2-(pyridin-2-ylmethyl)-1,3-benzothiazole.
What is the SMILES notation for 2-(pyridin-2-ylmethyl)-1,3-benzothiazole?
The canonical SMILES for 2-(pyridin-2-ylmethyl)-1,3-benzothiazole is c1ccc(Cc2nc3ccccc3s2)nc1.
What is the InChIKey of 2-(pyridin-2-ylmethyl)-1,3-benzothiazole?
The InChIKey is IYVPJYAPIITGLH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2S/c1-2-7-12-11(6-1)15-13(16-12)9-10-5-3-4-8-14-10/h1-8H,9H2.
What are the key properties of 2-(pyridin-2-ylmethyl)-1,3-benzothiazole?
2-(pyridin-2-ylmethyl)-1,3-benzothiazole has a molecular weight of 226.30 g/mol, XLogP of 3.28, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(pyridin-2-ylmethyl)-1,3-benzothiazole is sourced from PubChem (CID 2322343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).