C31H48N2O4S — CID 23224895
N'-(5,6-dimethoxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N-[2-(4-methylsulfonylphenyl)ethyl]-N'-propylhexane-1,6-diamine (PubChem CID 23224895) has the molecular formula C31H48N2O4S and a molecular weight of 544.80 g/mol. Its IUPAC name is N'-(5,6-dimethoxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N-[2-(4-methylsulfonylphenyl)ethyl]-N'-propylhexane-1,6-diamine.
| Compound Name | N'-(5,6-dimethoxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N-[2-(4-methylsulfonylphenyl)ethyl]-N'-propylhexane-1,6-diamine |
|---|---|
| PubChem CID | 23224895 |
| Molecular Formula | C31H48N2O4S |
| Molecular Weight | 544.80 g/mol |
| Exact Mass | 544.33 |
| IUPAC Name | N'-(5,6-dimethoxy-4-methyl-1,2,3,4-tetrahydronaphthalen-2-yl)-N-[2-(4-methylsulfonylphenyl)ethyl]-N'-propylhexane-1,6-diamine |
| SMILES | CCCN(CCCCCCNCCc1ccc(S(C)(=O)=O)cc1)C1Cc2ccc(OC)c(OC)c2C(C)C1 |
| InChI | InChI=1S/C31H48N2O4S/c1-6-20-33(27-22-24(2)30-26(23-27)13-16-29(36-3)31(30)37-4)21-10-8-7-9-18-32-19-17-25-11-14-28(15-12-25)38(5,34)35/h11-16,24,27,32H,6-10,17-23H2,1-5H3 |
| InChIKey | ZORVZNZQBUYZHL-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.80 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|