About 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole
2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole (PubChem CID 23225616) has the molecular formula C6H10N2S
and a molecular weight of 142.23 g/mol. Its IUPAC name is 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole.
Molecular Properties
| Compound Name | 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole |
| PubChem CID | 23225616 |
| Molecular Formula | C6H10N2S |
| Molecular Weight | 142.23 g/mol |
| Exact Mass | 142.06 |
| IUPAC Name | 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole |
| SMILES | C1CN(C2=NCCS2)C1 |
| InChI | InChI=1S/C6H10N2S/c1-3-8(4-1)6-7-2-5-9-6/h1-5H2 |
| InChIKey | GSZRSFBJOIKVQA-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 142.23 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole?
The IUPAC name of 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole (CID 23225616) is 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole.
What is the SMILES notation for 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole?
The canonical SMILES for 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole is C1CN(C2=NCCS2)C1.
What is the InChIKey of 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole?
The InChIKey is GSZRSFBJOIKVQA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2S/c1-3-8(4-1)6-7-2-5-9-6/h1-5H2.
What are the key properties of 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole?
2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole has a molecular weight of 142.23 g/mol, XLogP of 0.79, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(azetidin-1-yl)-4,5-dihydro-1,3-thiazole is sourced from PubChem (CID 23225616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).