C40H78N4 — CID 23225747
2,2,6,6-tetramethyl-4-[1,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine (PubChem CID 23225747) has the molecular formula C40H78N4 and a molecular weight of 615.09 g/mol. Its IUPAC name is 2,2,6,6-tetramethyl-4-[1,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine.
| Compound Name | 2,2,6,6-tetramethyl-4-[1,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine |
|---|---|
| PubChem CID | 23225747 |
| Molecular Formula | C40H78N4 |
| Molecular Weight | 615.09 g/mol |
| Exact Mass | 614.62 |
| IUPAC Name | 2,2,6,6-tetramethyl-4-[1,3,4-tris(2,2,6,6-tetramethylpiperidin-4-yl)butan-2-yl]piperidine |
| SMILES | CC1(C)CC(CC(C2CC(C)(C)NC(C)(C)C2)C(CC2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C40H78N4/c1-33(2)19-27(20-34(3,4)41-33)17-31(29-23-37(9,10)43-38(11,12)24-29)32(30-25-39(13,14)44-40(15,16)26-30)18-28-21-35(5,6)42-36(7,8)22-28/h27-32,41-44H,17-26H2,1-16H3 |
| InChIKey | JTOQKZZUERKRHA-UHFFFAOYSA-N |
| XLogP | 9.23 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.09 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |