C33H39F5N2O3 — CID 23225924
1,1,1-trifluorooctan-2-yl 4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoate (PubChem CID 23225924) has the molecular formula C33H39F5N2O3 and a molecular weight of 606.68 g/mol. Its IUPAC name is 1,1,1-trifluorooctan-2-yl 4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoate.
| Compound Name | 1,1,1-trifluorooctan-2-yl 4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoate |
|---|---|
| PubChem CID | 23225924 |
| Molecular Formula | C33H39F5N2O3 |
| Molecular Weight | 606.68 g/mol |
| Exact Mass | 606.29 |
| IUPAC Name | 1,1,1-trifluorooctan-2-yl 4-[2-[3-fluoro-4-(2-fluorooctoxy)phenyl]pyrimidin-5-yl]benzoate |
| SMILES | CCCCCCC(F)COc1ccc(-c2ncc(-c3ccc(C(=O)OC(CCCCCC)C(F)(F)F)cc3)cn2)cc1F |
| InChI | InChI=1S/C33H39F5N2O3/c1-3-5-7-9-11-27(34)22-42-29-18-17-25(19-28(29)35)31-39-20-26(21-40-31)23-13-15-24(16-14-23)32(41)43-30(33(36,37)38)12-10-8-6-4-2/h13-21,27,30H,3-12,22H2,1-2H3 |
| InChIKey | IDKHNCXVVGBGDH-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.68 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|