C11H6Cl2N4O3 — CID 2322667
N-(4,6-dichloropyrimidin-5-yl)-4-nitrobenzamide (PubChem CID 2322667) has the molecular formula C11H6Cl2N4O3 and a molecular weight of 313.10 g/mol. Its IUPAC name is N-(4,6-dichloropyrimidin-5-yl)-4-nitrobenzamide.
| Compound Name | N-(4,6-dichloropyrimidin-5-yl)-4-nitrobenzamide |
|---|---|
| PubChem CID | 2322667 |
| Molecular Formula | C11H6Cl2N4O3 |
| Molecular Weight | 313.10 g/mol |
| Exact Mass | 311.98 |
| IUPAC Name | N-(4,6-dichloropyrimidin-5-yl)-4-nitrobenzamide |
| SMILES | O=C(Nc1c(Cl)ncnc1Cl)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C11H6Cl2N4O3/c12-9-8(10(13)15-5-14-9)16-11(18)6-1-3-7(4-2-6)17(19)20/h1-5H,(H,16,18) |
| InChIKey | VHGLORAMUWIUEN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 98.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.10 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|