About 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide
4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide (PubChem CID 2322773) has the molecular formula C14H11N3O2S
and a molecular weight of 285.33 g/mol. Its IUPAC name is 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide.
Molecular Properties
| Compound Name | 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide |
| PubChem CID | 2322773 |
| Molecular Formula | C14H11N3O2S |
| Molecular Weight | 285.33 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide |
| SMILES | COc1ccc(C(=O)/N=c2/nc3ccccn3s2)cc1 |
| InChI | InChI=1S/C14H11N3O2S/c1-19-11-7-5-10(6-8-11)13(18)16-14-15-12-4-2-3-9-17(12)20-14/h2-9H,1H3/b16-14- |
| InChIKey | YJQJZYOAAZRCDK-PEZBUJJGSA-N |
| XLogP | 2.15 |
| TPSA | 55.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.33 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het_thio_N_5A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide?
The IUPAC name of 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide (CID 2322773) is 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide.
What is the SMILES notation for 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide?
The canonical SMILES for 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide is COc1ccc(C(=O)/N=c2/nc3ccccn3s2)cc1.
What is the InChIKey of 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide?
The InChIKey is YJQJZYOAAZRCDK-PEZBUJJGSA-N. The full InChI is InChI=1S/C14H11N3O2S/c1-19-11-7-5-10(6-8-11)13(18)16-14-15-12-4-2-3-9-17(12)20-14/h2-9H,1H3/b16-14-.
What are the key properties of 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide?
4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide has a molecular weight of 285.33 g/mol, XLogP of 2.15, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-N-([1,2,4]thiadiazolo[2,3-a]pyridin-2-ylidene)benzamide is sourced from PubChem (CID 2322773), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).