About 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole
5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole (PubChem CID 23227822) has the molecular formula C3H3N7
and a molecular weight of 137.11 g/mol. Its IUPAC name is 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole.
Molecular Properties
| Compound Name | 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole |
| PubChem CID | 23227822 |
| Molecular Formula | C3H3N7 |
| Molecular Weight | 137.11 g/mol |
| Exact Mass | 137.04 |
| IUPAC Name | 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole |
| SMILES | c1n[nH]c(-c2nn[nH]n2)n1 |
| InChI | InChI=1S/C3H3N7/c1-4-2(6-5-1)3-7-9-10-8-3/h1H,(H,4,5,6)(H,7,8,9,10) |
| InChIKey | FPNSQYRRKCTOMC-UHFFFAOYSA-N |
| XLogP | -1.02 |
| TPSA | 96.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.11 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole?
The IUPAC name of 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole (CID 23227822) is 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole.
What is the SMILES notation for 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole?
The canonical SMILES for 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole is c1n[nH]c(-c2nn[nH]n2)n1.
What is the InChIKey of 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole?
The InChIKey is FPNSQYRRKCTOMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H3N7/c1-4-2(6-5-1)3-7-9-10-8-3/h1H,(H,4,5,6)(H,7,8,9,10).
What are the key properties of 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole?
5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole has a molecular weight of 137.11 g/mol, XLogP of -1.02, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-1,2,4-triazol-5-yl)-2H-tetrazole is sourced from PubChem (CID 23227822), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).