C22H24N5OPS — CID 2322845
4-(2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl)morpholine (PubChem CID 2322845) has the molecular formula C22H24N5OPS and a molecular weight of 437.51 g/mol. Its IUPAC name is 4-(2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl)morpholine.
| Compound Name | 4-(2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl)morpholine |
|---|---|
| PubChem CID | 2322845 |
| Molecular Formula | C22H24N5OPS |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 4-(2,7-dimethyl-3,5-diphenyl-1-sulfanylidenepyrazolo[4,5-c][1,5,2]diazaphosphinin-1-yl)morpholine |
| SMILES | Cc1nn(-c2ccccc2)c2c1P(=S)(N1CCOCC1)N(C)C(c1ccccc1)=N2 |
| InChI | InChI=1S/C22H24N5OPS/c1-17-20-22(27(24-17)19-11-7-4-8-12-19)23-21(18-9-5-3-6-10-18)25(2)29(20,30)26-13-15-28-16-14-26/h3-12H,13-16H2,1-2H3 |
| InChIKey | UBEAGBMCQGLCOO-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 45.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|