C23H33NO8 — CID 23228661
tert-butyl (2S,4R)-4-hydroxy-2-[(R)-hydroxy-[(1S,2R,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 23228661) has the molecular formula C23H33NO8 and a molecular weight of 451.52 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-hydroxy-2-[(R)-hydroxy-[(1S,2R,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-hydroxy-2-[(R)-hydroxy-[(1S,2R,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 23228661 |
| Molecular Formula | C23H33NO8 |
| Molecular Weight | 451.52 g/mol |
| Exact Mass | 451.22 |
| IUPAC Name | tert-butyl (2S,4R)-4-hydroxy-2-[(R)-hydroxy-[(1S,2R,3S,4R,5R)-2-hydroxy-4-phenylmethoxy-6,8-dioxabicyclo[3.2.1]octan-3-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O)C[C@H]1[C@H](O)[C@H]1[C@@H](O)[C@@H]2CO[C@H](O2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C23H33NO8/c1-23(2,3)32-22(28)24-10-14(25)9-15(24)18(26)17-19(27)16-12-30-21(31-16)20(17)29-11-13-7-5-4-6-8-13/h4-8,14-21,25-27H,9-12H2,1-3H3/t14-,15+,16+,17+,18+,19+,20-,21-/m1/s1 |
| InChIKey | YPNYETOULCEFPA-COWJDMPJSA-N |
| XLogP | 1.04 |
| TPSA | 117.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.52 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |