C18H19NO3 — CID 23228754
(1R,4R,5S,8R,9R,10R,12S,13S)-6-(benzylamino)-2,7-dioxapentacyclo[6.5.0.04,12.05,10.09,13]tridecan-3-one (PubChem CID 23228754) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (1R,4R,5S,8R,9R,10R,12S,13S)-6-(benzylamino)-2,7-dioxapentacyclo[6.5.0.04,12.05,10.09,13]tridecan-3-one.
| Compound Name | (1R,4R,5S,8R,9R,10R,12S,13S)-6-(benzylamino)-2,7-dioxapentacyclo[6.5.0.04,12.05,10.09,13]tridecan-3-one |
|---|---|
| PubChem CID | 23228754 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (1R,4R,5S,8R,9R,10R,12S,13S)-6-(benzylamino)-2,7-dioxapentacyclo[6.5.0.04,12.05,10.09,13]tridecan-3-one |
| SMILES | O=C1O[C@H]2[C@@H]3OC(NCc4ccccc4)[C@H]4[C@@H]5C[C@H]([C@@H]14)[C@H]2[C@@H]53 |
| InChI | InChI=1S/C18H19NO3/c20-18-14-10-6-9-11-12(10)16(22-18)15(11)21-17(13(9)14)19-7-8-4-2-1-3-5-8/h1-5,9-17,19H,6-7H2/t9-,10+,11-,12+,13+,14-,15-,16-,17?/m1/s1 |
| InChIKey | MCZQLHXLRHBHJP-MLMOMFROSA-N |
| XLogP | 1.55 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |